C23H24N2O — CID 3667431
N-cyclopentyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide (PubChem CID 3667431) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is N-cyclopentyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide.
| Compound Name | N-cyclopentyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3667431 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-cyclopentyl-2-(2,4-dimethylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NC3CCCC3)c3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C23H24N2O/c1-15-11-12-18(16(2)13-15)22-14-20(19-9-5-6-10-21(19)25-22)23(26)24-17-7-3-4-8-17/h5-6,9-14,17H,3-4,7-8H2,1-2H3,(H,24,26) |
| InChIKey | FTULMSXCMANNCR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |