C18H15N3O — CID 757672
N-cyclopropyl-2-pyridin-2-ylquinoline-4-carboxamide (PubChem CID 757672) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is N-cyclopropyl-2-pyridin-2-ylquinoline-4-carboxamide.
| Compound Name | N-cyclopropyl-2-pyridin-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 757672 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-cyclopropyl-2-pyridin-2-ylquinoline-4-carboxamide |
| SMILES | O=C(NC1CC1)c1cc(-c2ccccn2)nc2ccccc12 |
| InChI | InChI=1S/C18H15N3O/c22-18(20-12-8-9-12)14-11-17(16-7-3-4-10-19-16)21-15-6-2-1-5-13(14)15/h1-7,10-12H,8-9H2,(H,20,22) |
| InChIKey | QOPVQFBKBKKNHS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |