C23H23FN2O — CID 42749913
N-cyclohexyl-2-(2-fluorophenyl)-6-methylquinoline-4-carboxamide (PubChem CID 42749913) has the molecular formula C23H23FN2O and a molecular weight of 362.45 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-fluorophenyl)-6-methylquinoline-4-carboxamide.
| Compound Name | N-cyclohexyl-2-(2-fluorophenyl)-6-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 42749913 |
| Molecular Formula | C23H23FN2O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-cyclohexyl-2-(2-fluorophenyl)-6-methylquinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccccc3F)cc(C(=O)NC3CCCCC3)c2c1 |
| InChI | InChI=1S/C23H23FN2O/c1-15-11-12-21-18(13-15)19(23(27)25-16-7-3-2-4-8-16)14-22(26-21)17-9-5-6-10-20(17)24/h5-6,9-14,16H,2-4,7-8H2,1H3,(H,25,27) |
| InChIKey | JSNSWXBXKPNQRL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |