C24H24FN3O3 — CID 42749933
ethyl 4-[2-(2-fluorophenyl)-6-methylquinoline-4-carbonyl]piperazine-1-carboxylate (PubChem CID 42749933) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is ethyl 4-[2-(2-fluorophenyl)-6-methylquinoline-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-fluorophenyl)-6-methylquinoline-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42749933 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | ethyl 4-[2-(2-fluorophenyl)-6-methylquinoline-4-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(-c3ccccc3F)nc3ccc(C)cc23)CC1 |
| InChI | InChI=1S/C24H24FN3O3/c1-3-31-24(30)28-12-10-27(11-13-28)23(29)19-15-22(17-6-4-5-7-20(17)25)26-21-9-8-16(2)14-18(19)21/h4-9,14-15H,3,10-13H2,1-2H3 |
| InChIKey | XYKUGKWRXXDODY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |