C24H25FN2O — CID 42750152
N-cyclohexyl-2-(3,4-dimethylphenyl)-6-fluoroquinoline-4-carboxamide (PubChem CID 42750152) has the molecular formula C24H25FN2O and a molecular weight of 376.48 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,4-dimethylphenyl)-6-fluoroquinoline-4-carboxamide.
| Compound Name | N-cyclohexyl-2-(3,4-dimethylphenyl)-6-fluoroquinoline-4-carboxamide |
|---|---|
| PubChem CID | 42750152 |
| Molecular Formula | C24H25FN2O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-cyclohexyl-2-(3,4-dimethylphenyl)-6-fluoroquinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NC3CCCCC3)c3cc(F)ccc3n2)cc1C |
| InChI | InChI=1S/C24H25FN2O/c1-15-8-9-17(12-16(15)2)23-14-21(20-13-18(25)10-11-22(20)27-23)24(28)26-19-6-4-3-5-7-19/h8-14,19H,3-7H2,1-2H3,(H,26,28) |
| InChIKey | MWXUDPFWHLUENJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |