C26H29FN4O2 — CID 155559458
6-fluoro-2-[4-(morpholin-4-ylmethyl)phenyl]-N-piperidin-4-ylquinoline-4-carboxamide (PubChem CID 155559458) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 6-fluoro-2-[4-(morpholin-4-ylmethyl)phenyl]-N-piperidin-4-ylquinoline-4-carboxamide.
| Compound Name | 6-fluoro-2-[4-(morpholin-4-ylmethyl)phenyl]-N-piperidin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 155559458 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 6-fluoro-2-[4-(morpholin-4-ylmethyl)phenyl]-N-piperidin-4-ylquinoline-4-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1cc(-c2ccc(CN3CCOCC3)cc2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C26H29FN4O2/c27-20-5-6-24-22(15-20)23(26(32)29-21-7-9-28-10-8-21)16-25(30-24)19-3-1-18(2-4-19)17-31-11-13-33-14-12-31/h1-6,15-16,21,28H,7-14,17H2,(H,29,32) |
| InChIKey | UNZTZXPXGDBXPX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |