C28H35FN4O — CID 155532654
4-[[4-[6-fluoro-4-[(4-propylpiperazin-1-yl)methyl]quinolin-2-yl]phenyl]methyl]morpholine (PubChem CID 155532654) has the molecular formula C28H35FN4O and a molecular weight of 462.61 g/mol. Its IUPAC name is 4-[[4-[6-fluoro-4-[(4-propylpiperazin-1-yl)methyl]quinolin-2-yl]phenyl]methyl]morpholine.
| Compound Name | 4-[[4-[6-fluoro-4-[(4-propylpiperazin-1-yl)methyl]quinolin-2-yl]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 155532654 |
| Molecular Formula | C28H35FN4O |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 4-[[4-[6-fluoro-4-[(4-propylpiperazin-1-yl)methyl]quinolin-2-yl]phenyl]methyl]morpholine |
| SMILES | CCCN1CCN(Cc2cc(-c3ccc(CN4CCOCC4)cc3)nc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C28H35FN4O/c1-2-9-31-10-12-32(13-11-31)21-24-18-28(30-27-8-7-25(29)19-26(24)27)23-5-3-22(4-6-23)20-33-14-16-34-17-15-33/h3-8,18-19H,2,9-17,20-21H2,1H3 |
| InChIKey | CZDFDAWAFAOVQV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |