C29H28FN3O2 — CID 155549517
6-fluoro-2-[4-(morpholin-4-ylmethyl)phenyl]-N-(1-phenylethyl)quinoline-4-carboxamide (PubChem CID 155549517) has the molecular formula C29H28FN3O2 and a molecular weight of 469.56 g/mol. Its IUPAC name is 6-fluoro-2-[4-(morpholin-4-ylmethyl)phenyl]-N-(1-phenylethyl)quinoline-4-carboxamide.
| Compound Name | 6-fluoro-2-[4-(morpholin-4-ylmethyl)phenyl]-N-(1-phenylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 155549517 |
| Molecular Formula | C29H28FN3O2 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 6-fluoro-2-[4-(morpholin-4-ylmethyl)phenyl]-N-(1-phenylethyl)quinoline-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccc(CN3CCOCC3)cc2)nc2ccc(F)cc12)c1ccccc1 |
| InChI | InChI=1S/C29H28FN3O2/c1-20(22-5-3-2-4-6-22)31-29(34)26-18-28(32-27-12-11-24(30)17-25(26)27)23-9-7-21(8-10-23)19-33-13-15-35-16-14-33/h2-12,17-18,20H,13-16,19H2,1H3,(H,31,34) |
| InChIKey | XHTMKPWQSUNYDU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |