C23H18FN3O — CID 112761308
2-(4-fluorophenyl)-N-(1-pyridin-4-ylethyl)quinoline-4-carboxamide (PubChem CID 112761308) has the molecular formula C23H18FN3O and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(1-pyridin-4-ylethyl)quinoline-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(1-pyridin-4-ylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 112761308 |
| Molecular Formula | C23H18FN3O |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(1-pyridin-4-ylethyl)quinoline-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccc(F)cc2)nc2ccccc12)c1ccncc1 |
| InChI | InChI=1S/C23H18FN3O/c1-15(16-10-12-25-13-11-16)26-23(28)20-14-22(17-6-8-18(24)9-7-17)27-21-5-3-2-4-19(20)21/h2-15H,1H3,(H,26,28) |
| InChIKey | MCVTVIJLWOYJPD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |