C25H20N6O — CID 166220183
N-[1-(1-phenyltriazol-4-yl)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 166220183) has the molecular formula C25H20N6O and a molecular weight of 420.48 g/mol. Its IUPAC name is N-[1-(1-phenyltriazol-4-yl)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[1-(1-phenyltriazol-4-yl)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 166220183 |
| Molecular Formula | C25H20N6O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[1-(1-phenyltriazol-4-yl)ethyl]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccncc2)nc2ccccc12)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C25H20N6O/c1-17(24-16-31(30-29-24)19-7-3-2-4-8-19)27-25(32)21-15-23(18-11-13-26-14-12-18)28-22-10-6-5-9-20(21)22/h2-17H,1H3,(H,27,32) |
| InChIKey | BUTAXVOUOKDDJU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |