C23H19N3O2 — CID 42654572
N-(2-hydroxy-2-phenylethyl)-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 42654572) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylethyl)-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-(2-hydroxy-2-phenylethyl)-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 42654572 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(2-hydroxy-2-phenylethyl)-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | O=C(NCC(O)c1ccccc1)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C23H19N3O2/c27-22(17-6-2-1-3-7-17)15-25-23(28)19-14-21(16-10-12-24-13-11-16)26-20-9-5-4-8-18(19)20/h1-14,22,27H,15H2,(H,25,28) |
| InChIKey | CJOAVFAPMOYVEJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |