C31H27N3O — CID 3397561
N-(3,3-diphenylpropyl)-6-methyl-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 3397561) has the molecular formula C31H27N3O and a molecular weight of 457.58 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-6-methyl-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-6-methyl-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3397561 |
| Molecular Formula | C31H27N3O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-(3,3-diphenylpropyl)-6-methyl-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccncc3)cc(C(=O)NCCC(c3ccccc3)c3ccccc3)c2c1 |
| InChI | InChI=1S/C31H27N3O/c1-22-12-13-29-27(20-22)28(21-30(34-29)25-14-17-32-18-15-25)31(35)33-19-16-26(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-15,17-18,20-21,26H,16,19H2,1H3,(H,33,35) |
| InChIKey | CRFPTGCSXKKNCG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |