C21H20N2O2 — CID 42534455
2-cyclopropyl-N-[(2R)-2-hydroxy-2-phenylethyl]quinoline-4-carboxamide (PubChem CID 42534455) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(2R)-2-hydroxy-2-phenylethyl]quinoline-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[(2R)-2-hydroxy-2-phenylethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 42534455 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-cyclopropyl-N-[(2R)-2-hydroxy-2-phenylethyl]quinoline-4-carboxamide |
| SMILES | O=C(NC[C@H](O)c1ccccc1)c1cc(C2CC2)nc2ccccc12 |
| InChI | InChI=1S/C21H20N2O2/c24-20(15-6-2-1-3-7-15)13-22-21(25)17-12-19(14-10-11-14)23-18-9-5-4-8-16(17)18/h1-9,12,14,20,24H,10-11,13H2,(H,22,25)/t20-/m0/s1 |
| InChIKey | SQGNBNCQGZWXKY-FQEVSTJZSA-N |
| XLogP | 3.58 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |