C22H16FN3O — CID 18206028
2-(4-fluorophenyl)-N-(6-methyl-2-pyridinyl)quinoline-4-carboxamide (PubChem CID 18206028) has the molecular formula C22H16FN3O and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(6-methyl-2-pyridinyl)quinoline-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(6-methyl-2-pyridinyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18206028 |
| Molecular Formula | C22H16FN3O |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(6-methyl-2-pyridinyl)quinoline-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)n1 |
| InChI | InChI=1S/C22H16FN3O/c1-14-5-4-8-21(24-14)26-22(27)18-13-20(15-9-11-16(23)12-10-15)25-19-7-3-2-6-17(18)19/h2-13H,1H3,(H,24,26,27) |
| InChIKey | ASAPAEUUKLJTTJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |