C19H12FN3OS — CID 2322249
2-(4-fluorophenyl)-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide (PubChem CID 2322249) has the molecular formula C19H12FN3OS and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2322249 |
| Molecular Formula | C19H12FN3OS |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C19H12FN3OS/c20-13-7-5-12(6-8-13)17-11-15(14-3-1-2-4-16(14)22-17)18(24)23-19-21-9-10-25-19/h1-11H,(H,21,23,24) |
| InChIKey | AFQCBYGLKOCGAH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |