C23H14FN3OS — CID 3252476
N-(6-fluoro-1,3-benzothiazol-2-yl)-2-phenylquinoline-4-carboxamide (PubChem CID 3252476) has the molecular formula C23H14FN3OS and a molecular weight of 399.45 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3252476 |
| Molecular Formula | C23H14FN3OS |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(Nc1nc2ccc(F)cc2s1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C23H14FN3OS/c24-15-10-11-19-21(12-15)29-23(26-19)27-22(28)17-13-20(14-6-2-1-3-7-14)25-18-9-5-4-8-16(17)18/h1-13H,(H,26,27,28) |
| InChIKey | PFRPNOSLFRMTPZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |