C32H21N3O2S — CID 4609567
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-2-phenylquinoline-4-carboxamide (PubChem CID 4609567) has the molecular formula C32H21N3O2S and a molecular weight of 511.61 g/mol. Its IUPAC name is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4609567 |
| Molecular Formula | C32H21N3O2S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(c1ccccc1)c1sc(NC(=O)c2cc(-c3ccccc3)nc3ccccc23)nc1-c1ccccc1 |
| InChI | InChI=1S/C32H21N3O2S/c36-29(23-16-8-3-9-17-23)30-28(22-14-6-2-7-15-22)34-32(38-30)35-31(37)25-20-27(21-12-4-1-5-13-21)33-26-19-11-10-18-24(25)26/h1-20H,(H,34,35,37) |
| InChIKey | TWLWQNAIIRRNQR-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |