C25H20N2O2S — CID 5048055
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3,4-dimethylbenzamide (PubChem CID 5048055) has the molecular formula C25H20N2O2S and a molecular weight of 412.51 g/mol. Its IUPAC name is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3,4-dimethylbenzamide.
| Compound Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 5048055 |
| Molecular Formula | C25H20N2O2S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(-c3ccccc3)c(C(=O)c3ccccc3)s2)cc1C |
| InChI | InChI=1S/C25H20N2O2S/c1-16-13-14-20(15-17(16)2)24(29)27-25-26-21(18-9-5-3-6-10-18)23(30-25)22(28)19-11-7-4-8-12-19/h3-15H,1-2H3,(H,26,27,29) |
| InChIKey | LBLFCUSXAFUXCP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |