C27H25N3O2S — CID 4682991
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-(diethylamino)benzamide (PubChem CID 4682991) has the molecular formula C27H25N3O2S and a molecular weight of 455.58 g/mol. Its IUPAC name is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-(diethylamino)benzamide.
| Compound Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-(diethylamino)benzamide |
|---|---|
| PubChem CID | 4682991 |
| Molecular Formula | C27H25N3O2S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-(diethylamino)benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)Nc2nc(-c3ccccc3)c(C(=O)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C27H25N3O2S/c1-3-30(4-2)22-17-15-21(16-18-22)26(32)29-27-28-23(19-11-7-5-8-12-19)25(33-27)24(31)20-13-9-6-10-14-20/h5-18H,3-4H2,1-2H3,(H,28,29,32) |
| InChIKey | VHBVYNIUFKHTFI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |