C24H18N2O2S — CID 7920283
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-phenylbenzamide (PubChem CID 7920283) has the molecular formula C24H18N2O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-phenylbenzamide.
| Compound Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 7920283 |
| Molecular Formula | C24H18N2O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-phenylbenzamide |
| SMILES | CC(=O)c1sc(NC(=O)c2ccc(-c3ccccc3)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H18N2O2S/c1-16(27)22-21(19-10-6-3-7-11-19)25-24(29-22)26-23(28)20-14-12-18(13-15-20)17-8-4-2-5-9-17/h2-15H,1H3,(H,25,26,28) |
| InChIKey | LAXOYLJWUMVWSO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |