C19H14F2N2O3S — CID 8918344
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-(difluoromethoxy)benzamide (PubChem CID 8918344) has the molecular formula C19H14F2N2O3S and a molecular weight of 388.40 g/mol. Its IUPAC name is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-(difluoromethoxy)benzamide.
| Compound Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 8918344 |
| Molecular Formula | C19H14F2N2O3S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-4-(difluoromethoxy)benzamide |
| SMILES | CC(=O)c1sc(NC(=O)c2ccc(OC(F)F)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H14F2N2O3S/c1-11(24)16-15(12-5-3-2-4-6-12)22-19(27-16)23-17(25)13-7-9-14(10-8-13)26-18(20)21/h2-10,18H,1H3,(H,22,23,25) |
| InChIKey | IEKVEVZPXNEYJA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |