C19H15BrN2O3S — CID 26196544
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-bromo-5-methoxybenzamide (PubChem CID 26196544) has the molecular formula C19H15BrN2O3S and a molecular weight of 431.31 g/mol. Its IUPAC name is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-bromo-5-methoxybenzamide.
| Compound Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-bromo-5-methoxybenzamide |
|---|---|
| PubChem CID | 26196544 |
| Molecular Formula | C19H15BrN2O3S |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-bromo-5-methoxybenzamide |
| SMILES | COc1ccc(Br)c(C(=O)Nc2nc(-c3ccccc3)c(C(C)=O)s2)c1 |
| InChI | InChI=1S/C19H15BrN2O3S/c1-11(23)17-16(12-6-4-3-5-7-12)21-19(26-17)22-18(24)14-10-13(25-2)8-9-15(14)20/h3-10H,1-2H3,(H,21,22,24) |
| InChIKey | VMQBYMOEOTZBEC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |