C28H19FN2OS — CID 126057357
N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]-4-phenylbenzamide (PubChem CID 126057357) has the molecular formula C28H19FN2OS and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]-4-phenylbenzamide.
| Compound Name | N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 126057357 |
| Molecular Formula | C28H19FN2OS |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]-4-phenylbenzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)c(-c2ccccc2)s1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H19FN2OS/c29-24-17-15-21(16-18-24)25-26(22-9-5-2-6-10-22)33-28(30-25)31-27(32)23-13-11-20(12-14-23)19-7-3-1-4-8-19/h1-18H,(H,30,31,32) |
| InChIKey | DYNGXQYVWVWTKG-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |