C22H13FN4O5S — CID 126058063
N-[4-(4-fluorophenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 126058063) has the molecular formula C22H13FN4O5S and a molecular weight of 464.43 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | N-[4-(4-fluorophenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126058063 |
| Molecular Formula | C22H13FN4O5S |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[4-(4-fluorophenyl)-5-(4-nitrophenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)c(-c2ccc([N+](=O)[O-])cc2)s1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H13FN4O5S/c23-16-8-4-13(5-9-16)19-20(14-6-10-17(11-7-14)26(29)30)33-22(24-19)25-21(28)15-2-1-3-18(12-15)27(31)32/h1-12H,(H,24,25,28) |
| InChIKey | BVRPYVXIOVKRHS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|