C22H15ClFN3O3S2 — CID 22911911
3-chloro-N-[4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 22911911) has the molecular formula C22H15ClFN3O3S2 and a molecular weight of 487.97 g/mol. Its IUPAC name is 3-chloro-N-[4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-chloro-N-[4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 22911911 |
| Molecular Formula | C22H15ClFN3O3S2 |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 3-chloro-N-[4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(-c2sc(NC(=O)c3cccc(Cl)c3)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H15ClFN3O3S2/c23-16-3-1-2-15(12-16)21(28)27-22-26-19(13-4-8-17(24)9-5-13)20(31-22)14-6-10-18(11-7-14)32(25,29)30/h1-12H,(H2,25,29,30)(H,26,27,28) |
| InChIKey | RPUFTVYIGHZDJN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |