C24H19FN2OS — CID 3914238
N-[4,5-bis(4-methylphenyl)-1,3-thiazol-2-yl]-3-fluorobenzamide (PubChem CID 3914238) has the molecular formula C24H19FN2OS and a molecular weight of 402.49 g/mol. Its IUPAC name is N-[4,5-bis(4-methylphenyl)-1,3-thiazol-2-yl]-3-fluorobenzamide.
| Compound Name | N-[4,5-bis(4-methylphenyl)-1,3-thiazol-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 3914238 |
| Molecular Formula | C24H19FN2OS |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[4,5-bis(4-methylphenyl)-1,3-thiazol-2-yl]-3-fluorobenzamide |
| SMILES | Cc1ccc(-c2nc(NC(=O)c3cccc(F)c3)sc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H19FN2OS/c1-15-6-10-17(11-7-15)21-22(18-12-8-16(2)9-13-18)29-24(26-21)27-23(28)19-4-3-5-20(25)14-19/h3-14H,1-2H3,(H,26,27,28) |
| InChIKey | RLGYCSJMQHHSND-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |