C15H11FN2OS — CID 46224235
3-(18F)fluoro-N-(6-methyl-1,3-benzothiazol-2-yl)(18F)benzamide (PubChem CID 46224235) has the molecular formula C15H11FN2OS and a molecular weight of 285.33 g/mol. Its IUPAC name is 3-(18F)fluoro-N-(6-methyl-1,3-benzothiazol-2-yl)(18F)benzamide.
| Compound Name | 3-(18F)fluoro-N-(6-methyl-1,3-benzothiazol-2-yl)(18F)benzamide |
|---|---|
| PubChem CID | 46224235 |
| Molecular Formula | C15H11FN2OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-(18F)fluoro-N-(6-methyl-1,3-benzothiazol-2-yl)(18F)benzamide |
| SMILES | Cc1ccc2nc(NC(=O)c3cccc([18F])c3)sc2c1 |
| InChI | InChI=1S/C15H11FN2OS/c1-9-5-6-12-13(7-9)20-15(17-12)18-14(19)10-3-2-4-11(16)8-10/h2-8H,1H3,(H,17,18,19)/i16-1 |
| InChIKey | UWTQMHBKIRAWCG-GKTGUEEDSA-N |
| XLogP | 4.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |