C16H13ClN2OS — CID 960429
N-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-3-methylbenzamide (PubChem CID 960429) has the molecular formula C16H13ClN2OS and a molecular weight of 316.81 g/mol. Its IUPAC name is N-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-3-methylbenzamide.
| Compound Name | N-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 960429 |
| Molecular Formula | C16H13ClN2OS |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | N-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)c1 |
| InChI | InChI=1S/C16H13ClN2OS/c1-9-4-3-5-11(6-9)15(20)19-16-18-13-8-12(17)10(2)7-14(13)21-16/h3-8H,1-2H3,(H,18,19,20) |
| InChIKey | JVMKJPUWSBWVEP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |