C17H15ClN2OS — CID 17100920
N-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-ethylbenzamide (PubChem CID 17100920) has the molecular formula C17H15ClN2OS and a molecular weight of 330.84 g/mol. Its IUPAC name is N-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-ethylbenzamide.
| Compound Name | N-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-ethylbenzamide |
|---|---|
| PubChem CID | 17100920 |
| Molecular Formula | C17H15ClN2OS |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2nc3cc(Cl)c(C)cc3s2)cc1 |
| InChI | InChI=1S/C17H15ClN2OS/c1-3-11-4-6-12(7-5-11)16(21)20-17-19-14-9-13(18)10(2)8-15(14)22-17/h4-9H,3H2,1-2H3,(H,19,20,21) |
| InChIKey | IXIRORDVBAKRLM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |