C21H24N2O2S — CID 41047701
N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide (PubChem CID 41047701) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide.
| Compound Name | N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 41047701 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2nc3cc(C)c(C)cc3s2)cc1 |
| InChI | InChI=1S/C21H24N2O2S/c1-4-5-6-11-25-17-9-7-16(8-10-17)20(24)23-21-22-18-12-14(2)15(3)13-19(18)26-21/h7-10,12-13H,4-6,11H2,1-3H3,(H,22,23,24) |
| InChIKey | SFVGZJGOJNPCSQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|