C20H21ClN2O2S — CID 42387687
N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide (PubChem CID 42387687) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide.
| Compound Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 42387687 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2nc3c(C)cc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C20H21ClN2O2S/c1-3-4-5-10-25-16-8-6-14(7-9-16)19(24)23-20-22-18-13(2)11-15(21)12-17(18)26-20/h6-9,11-12H,3-5,10H2,1-2H3,(H,22,23,24) |
| InChIKey | QFKVYGFHBASCMQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|