C18H16Cl2N2O2S — CID 40605559
4-butoxy-N-(4,5-dichloro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 40605559) has the molecular formula C18H16Cl2N2O2S and a molecular weight of 395.31 g/mol. Its IUPAC name is 4-butoxy-N-(4,5-dichloro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-butoxy-N-(4,5-dichloro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 40605559 |
| Molecular Formula | C18H16Cl2N2O2S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 4-butoxy-N-(4,5-dichloro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2nc3c(Cl)c(Cl)ccc3s2)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O2S/c1-2-3-10-24-12-6-4-11(5-7-12)17(23)22-18-21-16-14(25-18)9-8-13(19)15(16)20/h4-9H,2-3,10H2,1H3,(H,21,22,23) |
| InChIKey | XXIUDJLQWVBGBI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|