C17H15ClN2O3S2 — CID 7579507
N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-ethylsulfonylbenzamide (PubChem CID 7579507) has the molecular formula C17H15ClN2O3S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-ethylsulfonylbenzamide.
| Compound Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 7579507 |
| Molecular Formula | C17H15ClN2O3S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)Nc2nc3c(C)c(Cl)ccc3s2)cc1 |
| InChI | InChI=1S/C17H15ClN2O3S2/c1-3-25(22,23)12-6-4-11(5-7-12)16(21)20-17-19-15-10(2)13(18)8-9-14(15)24-17/h4-9H,3H2,1-2H3,(H,19,20,21) |
| InChIKey | JDZBWTPSTQHTOF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |