C18H16Cl2N2OS — CID 40603954
4-tert-butyl-N-(4,5-dichloro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 40603954) has the molecular formula C18H16Cl2N2OS and a molecular weight of 379.31 g/mol. Its IUPAC name is 4-tert-butyl-N-(4,5-dichloro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(4,5-dichloro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 40603954 |
| Molecular Formula | C18H16Cl2N2OS |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 4-tert-butyl-N-(4,5-dichloro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2nc3c(Cl)c(Cl)ccc3s2)cc1 |
| InChI | InChI=1S/C18H16Cl2N2OS/c1-18(2,3)11-6-4-10(5-7-11)16(23)22-17-21-15-13(24-17)9-8-12(19)14(15)20/h4-9H,1-3H3,(H,21,22,23) |
| InChIKey | SEIUGGVVSZKRAC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |