C19H17Cl2N3OS2 — CID 4306717
4-tert-butyl-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 4306717) has the molecular formula C19H17Cl2N3OS2 and a molecular weight of 438.41 g/mol. Its IUPAC name is 4-tert-butyl-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4306717 |
| Molecular Formula | C19H17Cl2N3OS2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 4-tert-butyl-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2nc3c(Cl)c(Cl)ccc3s2)cc1 |
| InChI | InChI=1S/C19H17Cl2N3OS2/c1-19(2,3)11-6-4-10(5-7-11)16(25)23-17(26)24-18-22-15-13(27-18)9-8-12(20)14(15)21/h4-9H,1-3H3,(H2,22,23,24,25,26) |
| InChIKey | SKEWOAHIXZSTGW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|