C16H10Cl3N3O2S2 — CID 3903778
3-chloro-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-4-methoxybenzamide (PubChem CID 3903778) has the molecular formula C16H10Cl3N3O2S2 and a molecular weight of 446.77 g/mol. Its IUPAC name is 3-chloro-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3-chloro-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 3903778 |
| Molecular Formula | C16H10Cl3N3O2S2 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 444.93 |
| IUPAC Name | 3-chloro-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2nc3c(Cl)c(Cl)ccc3s2)cc1Cl |
| InChI | InChI=1S/C16H10Cl3N3O2S2/c1-24-10-4-2-7(6-9(10)18)14(23)21-15(25)22-16-20-13-11(26-16)5-3-8(17)12(13)19/h2-6H,1H3,(H2,20,21,22,23,25) |
| InChIKey | KMUHOILGLKEFCZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|