C17H14ClN3O3S2 — CID 3913535
N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-2,6-dimethoxybenzamide (PubChem CID 3913535) has the molecular formula C17H14ClN3O3S2 and a molecular weight of 407.90 g/mol. Its IUPAC name is N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 3913535 |
| Molecular Formula | C17H14ClN3O3S2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)Nc1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C17H14ClN3O3S2/c1-23-10-6-4-7-11(24-2)13(10)15(22)20-16(25)21-17-19-14-9(18)5-3-8-12(14)26-17/h3-8H,1-2H3,(H2,19,20,21,22,25) |
| InChIKey | RCXHARHGWBTTBL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|