C19H11Cl2N3O2S2 — CID 4240554
N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide (PubChem CID 4240554) has the molecular formula C19H11Cl2N3O2S2 and a molecular weight of 448.36 g/mol. Its IUPAC name is N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4240554 |
| Molecular Formula | C19H11Cl2N3O2S2 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 446.97 |
| IUPAC Name | N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc2c(Cl)cccc2s1)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C19H11Cl2N3O2S2/c20-11-6-4-10(5-7-11)13-8-9-14(26-13)17(25)23-18(27)24-19-22-16-12(21)2-1-3-15(16)28-19/h1-9H,(H2,22,23,24,25,27) |
| InChIKey | QRHAUXBSEUUCJZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|