C14H10ClN3S2 — CID 3690824
1-(4-chloro-1,3-benzothiazol-2-yl)-3-phenylthiourea (PubChem CID 3690824) has the molecular formula C14H10ClN3S2 and a molecular weight of 319.84 g/mol. Its IUPAC name is 1-(4-chloro-1,3-benzothiazol-2-yl)-3-phenylthiourea.
| Compound Name | 1-(4-chloro-1,3-benzothiazol-2-yl)-3-phenylthiourea |
|---|---|
| PubChem CID | 3690824 |
| Molecular Formula | C14H10ClN3S2 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 1-(4-chloro-1,3-benzothiazol-2-yl)-3-phenylthiourea |
| SMILES | S=C(Nc1ccccc1)Nc1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C14H10ClN3S2/c15-10-7-4-8-11-12(10)17-14(20-11)18-13(19)16-9-5-2-1-3-6-9/h1-8H,(H2,16,17,18,19) |
| InChIKey | LZDZLKIDSIQXFN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|