C7H6ClN3S — CID 2049837
(4-chloro-1,3-benzothiazol-2-yl)hydrazine (PubChem CID 2049837) has the molecular formula C7H6ClN3S and a molecular weight of 199.67 g/mol. Its IUPAC name is (4-chloro-1,3-benzothiazol-2-yl)hydrazine.
| Compound Name | (4-chloro-1,3-benzothiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 2049837 |
| Molecular Formula | C7H6ClN3S |
| Molecular Weight | 199.67 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | (4-chloro-1,3-benzothiazol-2-yl)hydrazine |
| SMILES | NNc1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C7H6ClN3S/c8-4-2-1-3-5-6(4)10-7(11-9)12-5/h1-3H,9H2,(H,10,11) |
| InChIKey | VATAQQYXLCOZEX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.67 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|