C8H4Cl3NS — CID 119088723
4-chloro-2-(dichloromethyl)-1,3-benzothiazole (PubChem CID 119088723) has the molecular formula C8H4Cl3NS and a molecular weight of 252.55 g/mol. Its IUPAC name is 4-chloro-2-(dichloromethyl)-1,3-benzothiazole.
| Compound Name | 4-chloro-2-(dichloromethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 119088723 |
| Molecular Formula | C8H4Cl3NS |
| Molecular Weight | 252.55 g/mol |
| Exact Mass | 250.91 |
| IUPAC Name | 4-chloro-2-(dichloromethyl)-1,3-benzothiazole |
| SMILES | Clc1cccc2sc(C(Cl)Cl)nc12 |
| InChI | InChI=1S/C8H4Cl3NS/c9-4-2-1-3-5-6(4)12-8(13-5)7(10)11/h1-3,7H |
| InChIKey | WCPSIEFTWPAHPR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|