C13H7ClINS — CID 95910617
4-chloro-2-(4-iodophenyl)-1,3-benzothiazole (PubChem CID 95910617) has the molecular formula C13H7ClINS and a molecular weight of 371.63 g/mol. Its IUPAC name is 4-chloro-2-(4-iodophenyl)-1,3-benzothiazole.
| Compound Name | 4-chloro-2-(4-iodophenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 95910617 |
| Molecular Formula | C13H7ClINS |
| Molecular Weight | 371.63 g/mol |
| Exact Mass | 370.90 |
| IUPAC Name | 4-chloro-2-(4-iodophenyl)-1,3-benzothiazole |
| SMILES | Clc1cccc2sc(-c3ccc(I)cc3)nc12 |
| InChI | InChI=1S/C13H7ClINS/c14-10-2-1-3-11-12(10)16-13(17-11)8-4-6-9(15)7-5-8/h1-7H |
| InChIKey | HXGQYMDOBDXLRV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|