C13H7Cl3N2S — CID 50850275
2,4-dichloro-6-(4-chloro-1,3-benzothiazol-2-yl)aniline (PubChem CID 50850275) has the molecular formula C13H7Cl3N2S and a molecular weight of 329.64 g/mol. Its IUPAC name is 2,4-dichloro-6-(4-chloro-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 2,4-dichloro-6-(4-chloro-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 50850275 |
| Molecular Formula | C13H7Cl3N2S |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | 2,4-dichloro-6-(4-chloro-1,3-benzothiazol-2-yl)aniline |
| SMILES | Nc1c(Cl)cc(Cl)cc1-c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C13H7Cl3N2S/c14-6-4-7(11(17)9(16)5-6)13-18-12-8(15)2-1-3-10(12)19-13/h1-5H,17H2 |
| InChIKey | BKTDWYIYYLBXHD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|