C15H12ClNS — CID 95910467
4-chloro-2-(2,4-dimethylphenyl)-1,3-benzothiazole (PubChem CID 95910467) has the molecular formula C15H12ClNS and a molecular weight of 273.79 g/mol. Its IUPAC name is 4-chloro-2-(2,4-dimethylphenyl)-1,3-benzothiazole.
| Compound Name | 4-chloro-2-(2,4-dimethylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 95910467 |
| Molecular Formula | C15H12ClNS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 4-chloro-2-(2,4-dimethylphenyl)-1,3-benzothiazole |
| SMILES | Cc1ccc(-c2nc3c(Cl)cccc3s2)c(C)c1 |
| InChI | InChI=1S/C15H12ClNS/c1-9-6-7-11(10(2)8-9)15-17-14-12(16)4-3-5-13(14)18-15/h3-8H,1-2H3 |
| InChIKey | WJBJXZSWHTUXEJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |