C15H13NOS — CID 136750938
3-methyl-4-(5-methyl-1,3-benzothiazol-2-yl)phenol (PubChem CID 136750938) has the molecular formula C15H13NOS and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-methyl-4-(5-methyl-1,3-benzothiazol-2-yl)phenol.
| Compound Name | 3-methyl-4-(5-methyl-1,3-benzothiazol-2-yl)phenol |
|---|---|
| PubChem CID | 136750938 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-methyl-4-(5-methyl-1,3-benzothiazol-2-yl)phenol |
| SMILES | Cc1ccc2sc(-c3ccc(O)cc3C)nc2c1 |
| InChI | InChI=1S/C15H13NOS/c1-9-3-6-14-13(7-9)16-15(18-14)12-5-4-11(17)8-10(12)2/h3-8,17H,1-2H3 |
| InChIKey | BXVPHKJUKMGPMR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |