C15H11F3N2S — CID 79530408
2-(5-methyl-1,3-benzothiazol-2-yl)-5-(trifluoromethyl)aniline (PubChem CID 79530408) has the molecular formula C15H11F3N2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-(5-methyl-1,3-benzothiazol-2-yl)-5-(trifluoromethyl)aniline.
| Compound Name | 2-(5-methyl-1,3-benzothiazol-2-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 79530408 |
| Molecular Formula | C15H11F3N2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-(5-methyl-1,3-benzothiazol-2-yl)-5-(trifluoromethyl)aniline |
| SMILES | Cc1ccc2sc(-c3ccc(C(F)(F)F)cc3N)nc2c1 |
| InChI | InChI=1S/C15H11F3N2S/c1-8-2-5-13-12(6-8)20-14(21-13)10-4-3-9(7-11(10)19)15(16,17)18/h2-7H,19H2,1H3 |
| InChIKey | DYHCQQSTONYJAD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|