C14H11ClN2S — CID 43305050
5-chloro-2-(5-methyl-1,3-benzothiazol-2-yl)aniline (PubChem CID 43305050) has the molecular formula C14H11ClN2S and a molecular weight of 274.78 g/mol. Its IUPAC name is 5-chloro-2-(5-methyl-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 5-chloro-2-(5-methyl-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 43305050 |
| Molecular Formula | C14H11ClN2S |
| Molecular Weight | 274.78 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 5-chloro-2-(5-methyl-1,3-benzothiazol-2-yl)aniline |
| SMILES | Cc1ccc2sc(-c3ccc(Cl)cc3N)nc2c1 |
| InChI | InChI=1S/C14H11ClN2S/c1-8-2-5-13-12(6-8)17-14(18-13)10-4-3-9(15)7-11(10)16/h2-7H,16H2,1H3 |
| InChIKey | OYSCZNBCMZCYLG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.78 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|