C14H10ClNS — CID 135074846
5-chloro-2-(2-methylphenyl)-1,3-benzothiazole (PubChem CID 135074846) has the molecular formula C14H10ClNS and a molecular weight of 259.76 g/mol. Its IUPAC name is 5-chloro-2-(2-methylphenyl)-1,3-benzothiazole.
| Compound Name | 5-chloro-2-(2-methylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 135074846 |
| Molecular Formula | C14H10ClNS |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 5-chloro-2-(2-methylphenyl)-1,3-benzothiazole |
| SMILES | Cc1ccccc1-c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C14H10ClNS/c1-9-4-2-3-5-11(9)14-16-12-8-10(15)6-7-13(12)17-14/h2-8H,1H3 |
| InChIKey | JDMAVYONXLNWHK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |