C9H10ClNS — CID 163804732
5-chloro-2-methyl-1,3-benzothiazole;methane (PubChem CID 163804732) has the molecular formula C9H10ClNS and a molecular weight of 199.71 g/mol. Its IUPAC name is 5-chloro-2-methyl-1,3-benzothiazole;methane.
| Compound Name | 5-chloro-2-methyl-1,3-benzothiazole;methane |
|---|---|
| PubChem CID | 163804732 |
| Molecular Formula | C9H10ClNS |
| Molecular Weight | 199.71 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 5-chloro-2-methyl-1,3-benzothiazole;methane |
| SMILES | C.Cc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C8H6ClNS.CH4/c1-5-10-7-4-6(9)2-3-8(7)11-5;/h2-4H,1H3;1H4 |
| InChIKey | NIBGELMCSFCGTA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |