C9H9NOS2 — CID 94044690
2-methyl-5-[(S)-methylsulfinyl]-1,3-benzothiazole (PubChem CID 94044690) has the molecular formula C9H9NOS2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-methyl-5-[(S)-methylsulfinyl]-1,3-benzothiazole.
| Compound Name | 2-methyl-5-[(S)-methylsulfinyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 94044690 |
| Molecular Formula | C9H9NOS2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 2-methyl-5-[(S)-methylsulfinyl]-1,3-benzothiazole |
| SMILES | Cc1nc2cc([S@](C)=O)ccc2s1 |
| InChI | InChI=1S/C9H9NOS2/c1-6-10-8-5-7(13(2)11)3-4-9(8)12-6/h3-5H,1-2H3/t13-/m0/s1 |
| InChIKey | HSITZLZYYCYZDX-ZDUSSCGKSA-N |
| XLogP | 2.34 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |